C13H16N2O2 — CID 68912616
(4aS,10bS)-9-nitro-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]quinoline (PubChem CID 68912616) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is (4aS,10bS)-9-nitro-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]quinoline.
| Compound Name | (4aS,10bS)-9-nitro-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]quinoline |
|---|---|
| PubChem CID | 68912616 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (4aS,10bS)-9-nitro-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]quinoline |
| SMILES | O=[N+]([O-])c1ccc2c(c1)[C@@H]1CCCN[C@H]1CC2 |
| InChI | InChI=1S/C13H16N2O2/c16-15(17)10-5-3-9-4-6-13-11(12(9)8-10)2-1-7-14-13/h3,5,8,11,13-14H,1-2,4,6-7H2/t11-,13-/m0/s1 |
| InChIKey | XZABQDADIYZSMJ-AAEUAGOBSA-N |
| XLogP | 2.38 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|