C19H20F3NO — CID 87315200
1-[(4aS,9aR)-6-(cyclopenten-1-yl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 87315200) has the molecular formula C19H20F3NO and a molecular weight of 335.37 g/mol. Its IUPAC name is 1-[(4aS,9aR)-6-(cyclopenten-1-yl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(4aS,9aR)-6-(cyclopenten-1-yl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 87315200 |
| Molecular Formula | C19H20F3NO |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[(4aS,9aR)-6-(cyclopenten-1-yl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCC[C@H]2c3cc(C4=CCCC4)ccc3C[C@H]21)C(F)(F)F |
| InChI | InChI=1S/C19H20F3NO/c20-19(21,22)18(24)23-9-3-6-15-16-10-13(12-4-1-2-5-12)7-8-14(16)11-17(15)23/h4,7-8,10,15,17H,1-3,5-6,9,11H2/t15-,17+/m0/s1 |
| InChIKey | HRWRZDQSRIVIDN-DOTOQJQBSA-N |
| XLogP | 4.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |