C25H24N4O — CID 58294495
[(4aR,9aS)-6-(1-methylpyrazol-4-yl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(3H-indol-6-yl)methanone (PubChem CID 58294495) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is [(4aR,9aS)-6-(1-methylpyrazol-4-yl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(3H-indol-6-yl)methanone.
| Compound Name | [(4aR,9aS)-6-(1-methylpyrazol-4-yl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(3H-indol-6-yl)methanone |
|---|---|
| PubChem CID | 58294495 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [(4aR,9aS)-6-(1-methylpyrazol-4-yl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(3H-indol-6-yl)methanone |
| SMILES | Cn1cc(-c2ccc3c(c2)[C@H]2CCCN(C(=O)c4ccc5c(c4)N=CC5)[C@H]2C3)cn1 |
| InChI | InChI=1S/C25H24N4O/c1-28-15-20(14-27-28)17-5-6-18-13-24-21(22(18)11-17)3-2-10-29(24)25(30)19-7-4-16-8-9-26-23(16)12-19/h4-7,9,11-12,14-15,21,24H,2-3,8,10,13H2,1H3/t21-,24+/m1/s1 |
| InChIKey | IUFYJVOXMUEOFL-QPPBQGQZSA-N |
| XLogP | 4.29 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |