C20H21NO2 — CID 67223770
[(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(4-hydroxy-3-methylphenyl)methanone (PubChem CID 67223770) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is [(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(4-hydroxy-3-methylphenyl)methanone.
| Compound Name | [(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(4-hydroxy-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 67223770 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(4-hydroxy-3-methylphenyl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC[C@H]3c4ccccc4C[C@H]32)ccc1O |
| InChI | InChI=1S/C20H21NO2/c1-13-11-15(8-9-19(13)22)20(23)21-10-4-7-17-16-6-3-2-5-14(16)12-18(17)21/h2-3,5-6,8-9,11,17-18,22H,4,7,10,12H2,1H3/t17-,18+/m0/s1 |
| InChIKey | JLJOKSYZTJSXSE-ZWKOTPCHSA-N |
| XLogP | 3.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |