C21H23NO2 — CID 58294448
[(4aS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3-hydroxy-4-methylphenyl)methanone (PubChem CID 58294448) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is [(4aS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3-hydroxy-4-methylphenyl)methanone.
| Compound Name | [(4aS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3-hydroxy-4-methylphenyl)methanone |
|---|---|
| PubChem CID | 58294448 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | [(4aS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3-hydroxy-4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCCC3c4ccccc4CC[C@@H]32)cc1O |
| InChI | InChI=1S/C21H23NO2/c1-14-8-9-16(13-20(14)23)21(24)22-12-4-7-18-17-6-3-2-5-15(17)10-11-19(18)22/h2-3,5-6,8-9,13,18-19,23H,4,7,10-12H2,1H3/t18?,19-/m0/s1 |
| InChIKey | QHEAKBNYLPHEKB-GGYWPGCISA-N |
| XLogP | 4.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |