C19H18ClNO2 — CID 67969132
[(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(4-chloro-3-hydroxyphenyl)methanone (PubChem CID 67969132) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is [(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(4-chloro-3-hydroxyphenyl)methanone.
| Compound Name | [(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(4-chloro-3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 67969132 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | [(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(4-chloro-3-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c(O)c1)N1CCC[C@H]2c3ccccc3C[C@H]21 |
| InChI | InChI=1S/C19H18ClNO2/c20-16-8-7-13(11-18(16)22)19(23)21-9-3-6-15-14-5-2-1-4-12(14)10-17(15)21/h1-2,4-5,7-8,11,15,17,22H,3,6,9-10H2/t15-,17+/m0/s1 |
| InChIKey | ALHIQLXEDHIVKE-DOTOQJQBSA-N |
| XLogP | 3.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |