C19H19FN2O — CID 67224118
[(4aR,9aS)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(4-amino-3-fluorophenyl)methanone (PubChem CID 67224118) has the molecular formula C19H19FN2O and a molecular weight of 310.37 g/mol. Its IUPAC name is [(4aR,9aS)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(4-amino-3-fluorophenyl)methanone.
| Compound Name | [(4aR,9aS)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(4-amino-3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 67224118 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [(4aR,9aS)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(4-amino-3-fluorophenyl)methanone |
| SMILES | Nc1ccc(C(=O)N2CCC[C@@H]3c4ccccc4C[C@@H]32)cc1F |
| InChI | InChI=1S/C19H19FN2O/c20-16-10-13(7-8-17(16)21)19(23)22-9-3-6-15-14-5-2-1-4-12(14)11-18(15)22/h1-2,4-5,7-8,10,15,18H,3,6,9,11,21H2/t15-,18+/m1/s1 |
| InChIKey | MBBSEXKYQZBCGM-QAPCUYQASA-N |
| XLogP | 3.35 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|