C20H19N3OS — CID 76744261
2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl-(2-amino-1,3-benzothiazol-6-yl)methanone (PubChem CID 76744261) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is 2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl-(2-amino-1,3-benzothiazol-6-yl)methanone.
| Compound Name | 2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl-(2-amino-1,3-benzothiazol-6-yl)methanone |
|---|---|
| PubChem CID | 76744261 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl-(2-amino-1,3-benzothiazol-6-yl)methanone |
| SMILES | Nc1nc2ccc(C(=O)N3CCCC4c5ccccc5CC43)cc2s1 |
| InChI | InChI=1S/C20H19N3OS/c21-20-22-16-8-7-13(11-18(16)25-20)19(24)23-9-3-6-15-14-5-2-1-4-12(14)10-17(15)23/h1-2,4-5,7-8,11,15,17H,3,6,9-10H2,(H2,21,22) |
| InChIKey | LHTMBWOHTNBLDC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |