C21H20N2O — CID 67224579
[(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(1H-indol-5-yl)methanone (PubChem CID 67224579) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is [(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(1H-indol-5-yl)methanone.
| Compound Name | [(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(1H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 67224579 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | [(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(1H-indol-5-yl)methanone |
| SMILES | O=C(c1ccc2[nH]ccc2c1)N1CCC[C@H]2c3ccccc3C[C@H]21 |
| InChI | InChI=1S/C21H20N2O/c24-21(16-7-8-19-15(12-16)9-10-22-19)23-11-3-6-18-17-5-2-1-4-14(17)13-20(18)23/h1-2,4-5,7-10,12,18,20,22H,3,6,11,13H2/t18-,20+/m0/s1 |
| InChIKey | PZGYFIIATQBZMY-AZUAARDMSA-N |
| XLogP | 4.11 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |