C20H20N4O — CID 67969150
2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl-(2-amino-3H-benzimidazol-5-yl)methanone (PubChem CID 67969150) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl-(2-amino-3H-benzimidazol-5-yl)methanone.
| Compound Name | 2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl-(2-amino-3H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 67969150 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl-(2-amino-3H-benzimidazol-5-yl)methanone |
| SMILES | Nc1nc2ccc(C(=O)N3CCCC4c5ccccc5CC43)cc2[nH]1 |
| InChI | InChI=1S/C20H20N4O/c21-20-22-16-8-7-13(10-17(16)23-20)19(25)24-9-3-6-15-14-5-2-1-4-12(14)11-18(15)24/h1-2,4-5,7-8,10,15,18H,3,6,9,11H2,(H3,21,22,23) |
| InChIKey | CKCPVILKBNAHHT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |