C20H19N3O — CID 67223182
[(4aR,9aS)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-imidazo[1,2-a]pyridin-7-ylmethanone (PubChem CID 67223182) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is [(4aR,9aS)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-imidazo[1,2-a]pyridin-7-ylmethanone.
| Compound Name | [(4aR,9aS)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-imidazo[1,2-a]pyridin-7-ylmethanone |
|---|---|
| PubChem CID | 67223182 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | [(4aR,9aS)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-imidazo[1,2-a]pyridin-7-ylmethanone |
| SMILES | O=C(c1ccn2ccnc2c1)N1CCC[C@@H]2c3ccccc3C[C@@H]21 |
| InChI | InChI=1S/C20H19N3O/c24-20(15-7-10-22-11-8-21-19(22)13-15)23-9-3-6-17-16-5-2-1-4-14(16)12-18(17)23/h1-2,4-5,7-8,10-11,13,17-18H,3,6,9,12H2/t17-,18+/m1/s1 |
| InChIKey | DGWCPDMVXBWGCL-MSOLQXFVSA-N |
| XLogP | 3.28 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |