C20H20N4O — CID 67969110
[(4aR,10bS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(2H-benzotriazol-5-yl)methanone (PubChem CID 67969110) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is [(4aR,10bS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(2H-benzotriazol-5-yl)methanone.
| Compound Name | [(4aR,10bS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(2H-benzotriazol-5-yl)methanone |
|---|---|
| PubChem CID | 67969110 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | [(4aR,10bS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(2H-benzotriazol-5-yl)methanone |
| SMILES | O=C(c1ccc2n[nH]nc2c1)N1CCC[C@H]2c3ccccc3CC[C@H]21 |
| InChI | InChI=1S/C20H20N4O/c25-20(14-7-9-17-18(12-14)22-23-21-17)24-11-3-6-16-15-5-2-1-4-13(15)8-10-19(16)24/h1-2,4-5,7,9,12,16,19H,3,6,8,10-11H2,(H,21,22,23)/t16-,19+/m0/s1 |
| InChIKey | YIZOWVCFUAOCJR-QFBILLFUSA-N |
| XLogP | 3.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |