C20H21ClN2O — CID 58294602
[(4aS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(4-amino-3-chlorophenyl)methanone (PubChem CID 58294602) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is [(4aS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(4-amino-3-chlorophenyl)methanone.
| Compound Name | [(4aS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(4-amino-3-chlorophenyl)methanone |
|---|---|
| PubChem CID | 58294602 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [(4aS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(4-amino-3-chlorophenyl)methanone |
| SMILES | Nc1ccc(C(=O)N2CCCC3c4ccccc4CC[C@@H]32)cc1Cl |
| InChI | InChI=1S/C20H21ClN2O/c21-17-12-14(7-9-18(17)22)20(24)23-11-3-6-16-15-5-2-1-4-13(15)8-10-19(16)23/h1-2,4-5,7,9,12,16,19H,3,6,8,10-11,22H2/t16?,19-/m0/s1 |
| InChIKey | SIFBLFPDTSIMLQ-CVMIBEPCSA-N |
| XLogP | 4.26 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|