C21H20N2O2S — CID 67223288
6-[(4aR,10bS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-4-carbonyl]-3H-1,3-benzothiazol-2-one (PubChem CID 67223288) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 6-[(4aR,10bS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-4-carbonyl]-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-[(4aR,10bS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-4-carbonyl]-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 67223288 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 6-[(4aR,10bS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-4-carbonyl]-3H-1,3-benzothiazol-2-one |
| SMILES | O=C(c1ccc2[nH]c(=O)sc2c1)N1CCC[C@H]2c3ccccc3CC[C@H]21 |
| InChI | InChI=1S/C21H20N2O2S/c24-20(14-7-9-17-19(12-14)26-21(25)22-17)23-11-3-6-16-15-5-2-1-4-13(15)8-10-18(16)23/h1-2,4-5,7,9,12,16,18H,3,6,8,10-11H2,(H,22,25)/t16-,18+/m0/s1 |
| InChIKey | LYWCPSCWTUZDTE-FUHWJXTLSA-N |
| XLogP | 3.92 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |