C23H24N2O2 — CID 58294403
[(4aR)-8-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-indol-6-yl)methanone (PubChem CID 58294403) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is [(4aR)-8-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-indol-6-yl)methanone.
| Compound Name | [(4aR)-8-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-indol-6-yl)methanone |
|---|---|
| PubChem CID | 58294403 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [(4aR)-8-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-indol-6-yl)methanone |
| SMILES | COc1ccc2c(c1)CC[C@@H]1C2CCCN1C(=O)c1ccc2c(c1)N=CC2 |
| InChI | InChI=1S/C23H24N2O2/c1-27-18-7-8-19-16(13-18)6-9-22-20(19)3-2-12-25(22)23(26)17-5-4-15-10-11-24-21(15)14-17/h4-5,7-8,11,13-14,20,22H,2-3,6,9-10,12H2,1H3/t20?,22-/m1/s1 |
| InChIKey | UIWIDYSPPPGYID-LWMIZPGFSA-N |
| XLogP | 4.29 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |