C23H24N2O2 — CID 58294482
[(4aR,9aS)-6-methoxy-5-methyl-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(3H-indol-6-yl)methanone (PubChem CID 58294482) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is [(4aR,9aS)-6-methoxy-5-methyl-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(3H-indol-6-yl)methanone.
| Compound Name | [(4aR,9aS)-6-methoxy-5-methyl-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(3H-indol-6-yl)methanone |
|---|---|
| PubChem CID | 58294482 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [(4aR,9aS)-6-methoxy-5-methyl-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(3H-indol-6-yl)methanone |
| SMILES | COc1ccc2c(c1C)[C@H]1CCCN(C(=O)c3ccc4c(c3)N=CC4)[C@H]1C2 |
| InChI | InChI=1S/C23H24N2O2/c1-14-21(27-2)8-7-16-13-20-18(22(14)16)4-3-11-25(20)23(26)17-6-5-15-9-10-24-19(15)12-17/h5-8,10,12,18,20H,3-4,9,11,13H2,1-2H3/t18-,20-/m0/s1 |
| InChIKey | MNIPUHKXGCGVDO-ICSRJNTNSA-N |
| XLogP | 4.21 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |