C26H30N2O2 — CID 58375306
3H-indol-5-yl-[(1S,9S)-4-methoxy-1,5,13,13-tetramethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone (PubChem CID 58375306) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 3H-indol-5-yl-[(1S,9S)-4-methoxy-1,5,13,13-tetramethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone.
| Compound Name | 3H-indol-5-yl-[(1S,9S)-4-methoxy-1,5,13,13-tetramethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone |
|---|---|
| PubChem CID | 58375306 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 3H-indol-5-yl-[(1S,9S)-4-methoxy-1,5,13,13-tetramethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone |
| SMILES | COc1cc2c(cc1C)C[C@@H]1N(C(=O)c3ccc4c(c3)CC=N4)CC[C@]2(C)C1(C)C |
| InChI | InChI=1S/C26H30N2O2/c1-16-12-19-14-23-25(2,3)26(4,20(19)15-22(16)30-5)9-11-28(23)24(29)18-6-7-21-17(13-18)8-10-27-21/h6-7,10,12-13,15,23H,8-9,11,14H2,1-5H3/t23-,26-/m0/s1 |
| InChIKey | VUCAXKHALGDRPC-OZXSUGGESA-N |
| XLogP | 5.02 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |