C27H29N5O — CID 77270676
3H-benzimidazol-5-yl-(1,6,7,17,17-pentamethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaen-14-yl)methanone (PubChem CID 77270676) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-(1,6,7,17,17-pentamethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaen-14-yl)methanone.
| Compound Name | 3H-benzimidazol-5-yl-(1,6,7,17,17-pentamethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaen-14-yl)methanone |
|---|---|
| PubChem CID | 77270676 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 3H-benzimidazol-5-yl-(1,6,7,17,17-pentamethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaen-14-yl)methanone |
| SMILES | Cc1nc2cc3c(cc2nc1C)C1(C)CCN(C(=O)c2ccc4nc[nH]c4c2)C(C3)C1(C)C |
| InChI | InChI=1S/C27H29N5O/c1-15-16(2)31-23-13-19-18(11-22(23)30-15)12-24-26(3,4)27(19,5)8-9-32(24)25(33)17-6-7-20-21(10-17)29-14-28-20/h6-7,10-11,13-14,24H,8-9,12H2,1-5H3,(H,28,29) |
| InChIKey | OILAXHKXTOONOC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |