C28H30N4O — CID 58375200
3H-indol-5-yl-[(1S,13R)-1,6,7,17,17-pentamethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaen-14-yl]methanone (PubChem CID 58375200) has the molecular formula C28H30N4O and a molecular weight of 438.58 g/mol. Its IUPAC name is 3H-indol-5-yl-[(1S,13R)-1,6,7,17,17-pentamethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaen-14-yl]methanone.
| Compound Name | 3H-indol-5-yl-[(1S,13R)-1,6,7,17,17-pentamethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaen-14-yl]methanone |
|---|---|
| PubChem CID | 58375200 |
| Molecular Formula | C28H30N4O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 3H-indol-5-yl-[(1S,13R)-1,6,7,17,17-pentamethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaen-14-yl]methanone |
| SMILES | Cc1nc2cc3c(cc2nc1C)[C@]1(C)CCN(C(=O)c2ccc4c(c2)CC=N4)[C@H](C3)C1(C)C |
| InChI | InChI=1S/C28H30N4O/c1-16-17(2)31-24-15-21-20(13-23(24)30-16)14-25-27(3,4)28(21,5)9-11-32(25)26(33)19-6-7-22-18(12-19)8-10-29-22/h6-7,10,12-13,15,25H,8-9,11,14H2,1-5H3/t25-,28+/m1/s1 |
| InChIKey | GDHDRKKKWQDJGI-NAKRPHOHSA-N |
| XLogP | 5.26 |
| TPSA | 58.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |