C24H26N2O2 — CID 58374960
(4-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)-(3H-indol-5-yl)methanone (PubChem CID 58374960) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is (4-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)-(3H-indol-5-yl)methanone.
| Compound Name | (4-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)-(3H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 58374960 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (4-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)-(3H-indol-5-yl)methanone |
| SMILES | CC12CCN(C(=O)c3ccc4c(c3)CC=N4)C(Cc3ccc(O)cc31)C2(C)C |
| InChI | InChI=1S/C24H26N2O2/c1-23(2)21-13-15-4-6-18(27)14-19(15)24(23,3)9-11-26(21)22(28)17-5-7-20-16(12-17)8-10-25-20/h4-7,10,12,14,21,27H,8-9,11,13H2,1-3H3 |
| InChIKey | DKZZOJMZFOSDJD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |