C22H25FN2O — CID 58375239
(4-amino-3-fluorophenyl)-[(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone (PubChem CID 58375239) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is (4-amino-3-fluorophenyl)-[(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone.
| Compound Name | (4-amino-3-fluorophenyl)-[(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone |
|---|---|
| PubChem CID | 58375239 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (4-amino-3-fluorophenyl)-[(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone |
| SMILES | CC1(C)[C@H]2Cc3ccccc3[C@]1(C)CCN2C(=O)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C22H25FN2O/c1-21(2)19-13-14-6-4-5-7-16(14)22(21,3)10-11-25(19)20(26)15-8-9-18(24)17(23)12-15/h4-9,12,19H,10-11,13,24H2,1-3H3/t19-,22+/m1/s1 |
| InChIKey | FSGIUMIKLLBUQF-KNQAVFIVSA-N |
| XLogP | 4.16 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|