C27H31N3O2 — CID 58375258
(1S,9R)-10-(3H-indole-5-carbonyl)-N,N,1,13,13-pentamethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-6-carboxamide (PubChem CID 58375258) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is (1S,9R)-10-(3H-indole-5-carbonyl)-N,N,1,13,13-pentamethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-6-carboxamide.
| Compound Name | (1S,9R)-10-(3H-indole-5-carbonyl)-N,N,1,13,13-pentamethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-6-carboxamide |
|---|---|
| PubChem CID | 58375258 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (1S,9R)-10-(3H-indole-5-carbonyl)-N,N,1,13,13-pentamethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-6-carboxamide |
| SMILES | CN(C)C(=O)c1cccc2c1C[C@H]1N(C(=O)c3ccc4c(c3)CC=N4)CC[C@]2(C)C1(C)C |
| InChI | InChI=1S/C27H31N3O2/c1-26(2)23-16-20-19(25(32)29(4)5)7-6-8-21(20)27(26,3)12-14-30(23)24(31)18-9-10-22-17(15-18)11-13-28-22/h6-10,13,15,23H,11-12,14,16H2,1-5H3/t23-,27+/m1/s1 |
| InChIKey | XEACCRGSRLKUGJ-KCWPFWIISA-N |
| XLogP | 4.40 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |