C26H28N4O — CID 58375068
3H-indol-5-yl-[(1S,12S)-1,7,16,16-tetramethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]methanone (PubChem CID 58375068) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is 3H-indol-5-yl-[(1S,12S)-1,7,16,16-tetramethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]methanone.
| Compound Name | 3H-indol-5-yl-[(1S,12S)-1,7,16,16-tetramethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]methanone |
|---|---|
| PubChem CID | 58375068 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 3H-indol-5-yl-[(1S,12S)-1,7,16,16-tetramethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]methanone |
| SMILES | Cn1cnc2cc3c(cc21)C[C@@H]1N(C(=O)c2ccc4c(c2)CC=N4)CC[C@]3(C)C1(C)C |
| InChI | InChI=1S/C26H28N4O/c1-25(2)23-13-18-12-22-21(28-15-29(22)4)14-19(18)26(25,3)8-10-30(23)24(31)17-5-6-20-16(11-17)7-9-27-20/h5-6,9,11-12,14-15,23H,7-8,10,13H2,1-4H3/t23-,26-/m0/s1 |
| InChIKey | KIKABBOQKVIYCC-OZXSUGGESA-N |
| XLogP | 4.59 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |