C26H27N5O — CID 67344629
3H-benzimidazol-5-yl-[(1S,13R)-1,6,17,17-tetramethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaen-14-yl]methanone (PubChem CID 67344629) has the molecular formula C26H27N5O and a molecular weight of 425.54 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-[(1S,13R)-1,6,17,17-tetramethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaen-14-yl]methanone.
| Compound Name | 3H-benzimidazol-5-yl-[(1S,13R)-1,6,17,17-tetramethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaen-14-yl]methanone |
|---|---|
| PubChem CID | 67344629 |
| Molecular Formula | C26H27N5O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 3H-benzimidazol-5-yl-[(1S,13R)-1,6,17,17-tetramethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaen-14-yl]methanone |
| SMILES | Cc1cnc2cc3c(cc2n1)[C@]1(C)CCN(C(=O)c2ccc4nc[nH]c4c2)[C@H](C3)C1(C)C |
| InChI | InChI=1S/C26H27N5O/c1-15-13-27-21-10-17-11-23-25(2,3)26(4,18(17)12-22(21)30-15)7-8-31(23)24(32)16-5-6-19-20(9-16)29-14-28-19/h5-6,9-10,12-14,23H,7-8,11H2,1-4H3,(H,28,29)/t23-,26+/m1/s1 |
| InChIKey | YFOCYWAUAVJYKJ-BVAGGSTKSA-N |
| XLogP | 4.57 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |