C24H26N2O2 — CID 126494195
[(9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(1H-indol-5-yl)methanone (PubChem CID 126494195) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is [(9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(1H-indol-5-yl)methanone.
| Compound Name | [(9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(1H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 126494195 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | [(9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(1H-indol-5-yl)methanone |
| SMILES | CC12CCN(C(=O)c3ccc4[nH]ccc4c3)[C@H](Cc3c(O)cccc31)C2(C)C |
| InChI | InChI=1S/C24H26N2O2/c1-23(2)21-14-17-18(5-4-6-20(17)27)24(23,3)10-12-26(21)22(28)16-7-8-19-15(13-16)9-11-25-19/h4-9,11,13,21,25,27H,10,12,14H2,1-3H3/t21-,24?/m1/s1 |
| InChIKey | PPBLINMSOFXEMA-CILPGNKCSA-N |
| XLogP | 4.63 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |