C26H33N3O2 — CID 143805230
[(1S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(4-piperazin-1-ylphenyl)methanone (PubChem CID 143805230) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is [(1S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(4-piperazin-1-ylphenyl)methanone.
| Compound Name | [(1S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(4-piperazin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 143805230 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | [(1S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(4-piperazin-1-ylphenyl)methanone |
| SMILES | CC1(C)C2Cc3c(O)cccc3[C@]1(C)CCN2C(=O)c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C26H33N3O2/c1-25(2)23-17-20-21(5-4-6-22(20)30)26(25,3)11-14-29(23)24(31)18-7-9-19(10-8-18)28-15-12-27-13-16-28/h4-10,23,27,30H,11-17H2,1-3H3/t23?,26-/m0/s1 |
| InChIKey | JRFGMCBBGKSGDG-NASUQTAISA-N |
| XLogP | 3.56 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |