C23H27NO2 — CID 126494141
[(1S,9R)-13-ethyl-6-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-phenylmethanone (PubChem CID 126494141) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is [(1S,9R)-13-ethyl-6-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-phenylmethanone.
| Compound Name | [(1S,9R)-13-ethyl-6-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-phenylmethanone |
|---|---|
| PubChem CID | 126494141 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | [(1S,9R)-13-ethyl-6-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-phenylmethanone |
| SMILES | CCC1(C)[C@H]2Cc3c(O)cccc3[C@]1(C)CCN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H27NO2/c1-4-22(2)20-15-17-18(11-8-12-19(17)25)23(22,3)13-14-24(20)21(26)16-9-6-5-7-10-16/h5-12,20,25H,4,13-15H2,1-3H3/t20-,22?,23+/m1/s1 |
| InChIKey | VWEYHTGDWAFSRW-FQXDTITESA-N |
| XLogP | 4.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |