C23H25N3O2 — CID 67344296
3H-benzimidazol-5-yl-(5-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)methanone (PubChem CID 67344296) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-(5-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)methanone.
| Compound Name | 3H-benzimidazol-5-yl-(5-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)methanone |
|---|---|
| PubChem CID | 67344296 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 3H-benzimidazol-5-yl-(5-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)methanone |
| SMILES | CC12CCN(C(=O)c3ccc4nc[nH]c4c3)C(Cc3cc(O)ccc31)C2(C)C |
| InChI | InChI=1S/C23H25N3O2/c1-22(2)20-12-15-10-16(27)5-6-17(15)23(22,3)8-9-26(20)21(28)14-4-7-18-19(11-14)25-13-24-18/h4-7,10-11,13,20,27H,8-9,12H2,1-3H3,(H,24,25) |
| InChIKey | PHZZNTWTRCIXJO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |