C24H24N4O — CID 126493806
(1S)-10-(3H-benzimidazole-5-carbonyl)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carbonitrile (PubChem CID 126493806) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is (1S)-10-(3H-benzimidazole-5-carbonyl)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carbonitrile.
| Compound Name | (1S)-10-(3H-benzimidazole-5-carbonyl)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carbonitrile |
|---|---|
| PubChem CID | 126493806 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (1S)-10-(3H-benzimidazole-5-carbonyl)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carbonitrile |
| SMILES | CC1(C)C2Cc3cc(C#N)ccc3[C@]1(C)CCN2C(=O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C24H24N4O/c1-23(2)21-12-17-10-15(13-25)4-6-18(17)24(23,3)8-9-28(21)22(29)16-5-7-19-20(11-16)27-14-26-19/h4-7,10-11,14,21H,8-9,12H2,1-3H3,(H,26,27)/t21?,24-/m0/s1 |
| InChIKey | PTZXGWMPTDSWDR-FHZUCYEKSA-N |
| XLogP | 4.19 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |