C23H22N4O — CID 143805302
(1R,13S)-10-(3H-benzimidazole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carbonitrile (PubChem CID 143805302) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is (1R,13S)-10-(3H-benzimidazole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carbonitrile.
| Compound Name | (1R,13S)-10-(3H-benzimidazole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carbonitrile |
|---|---|
| PubChem CID | 143805302 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (1R,13S)-10-(3H-benzimidazole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carbonitrile |
| SMILES | C[C@@H]1C2Cc3ccc(C#N)cc3[C@]1(C)CCN2C(=O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C23H22N4O/c1-14-21-11-16-4-3-15(12-24)9-18(16)23(14,2)7-8-27(21)22(28)17-5-6-19-20(10-17)26-13-25-19/h3-6,9-10,13-14,21H,7-8,11H2,1-2H3,(H,25,26)/t14-,21?,23-/m1/s1 |
| InChIKey | KXQYYHGVVWPMPT-YSKCATNHSA-N |
| XLogP | 3.80 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |