C24H27N5O — CID 143805241
(1,16-dimethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl)-[3-(methylamino)-4-(methylideneamino)phenyl]methanone (PubChem CID 143805241) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is (1,16-dimethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl)-[3-(methylamino)-4-(methylideneamino)phenyl]methanone.
| Compound Name | (1,16-dimethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl)-[3-(methylamino)-4-(methylideneamino)phenyl]methanone |
|---|---|
| PubChem CID | 143805241 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | (1,16-dimethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl)-[3-(methylamino)-4-(methylideneamino)phenyl]methanone |
| SMILES | C=Nc1ccc(C(=O)N2CCC3(C)c4cc5nc[nH]c5cc4CC2C3C)cc1NC |
| InChI | InChI=1S/C24H27N5O/c1-14-22-11-16-10-20-21(28-13-27-20)12-17(16)24(14,2)7-8-29(22)23(30)15-5-6-18(25-3)19(9-15)26-4/h5-6,9-10,12-14,22,26H,3,7-8,11H2,1-2,4H3,(H,27,28) |
| InChIKey | XXUIDKWXYRQBRG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|