C27H27N5O2 — CID 126494224
6-[(1R,13S)-10-(3H-benzimidazole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]-2-methylpyridazin-3-one (PubChem CID 126494224) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 6-[(1R,13S)-10-(3H-benzimidazole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]-2-methylpyridazin-3-one.
| Compound Name | 6-[(1R,13S)-10-(3H-benzimidazole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 126494224 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 6-[(1R,13S)-10-(3H-benzimidazole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]-2-methylpyridazin-3-one |
| SMILES | C[C@@H]1C2Cc3ccc(-c4ccc(=O)n(C)n4)cc3[C@]1(C)CCN2C(=O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C27H27N5O2/c1-16-24-14-17-4-5-18(21-8-9-25(33)31(3)30-21)12-20(17)27(16,2)10-11-32(24)26(34)19-6-7-22-23(13-19)29-15-28-22/h4-9,12-13,15-16,24H,10-11,14H2,1-3H3,(H,28,29)/t16-,24?,27-/m1/s1 |
| InChIKey | ZMMPWWSTSRCPRB-YTJSEKOESA-N |
| XLogP | 3.69 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |