C28H28N4O2 — CID 67345457
4-[(1R,9R,13S)-10-(3H-benzimidazole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]-1-methylpyridin-2-one (PubChem CID 67345457) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 4-[(1R,9R,13S)-10-(3H-benzimidazole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]-1-methylpyridin-2-one.
| Compound Name | 4-[(1R,9R,13S)-10-(3H-benzimidazole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 67345457 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 4-[(1R,9R,13S)-10-(3H-benzimidazole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]-1-methylpyridin-2-one |
| SMILES | C[C@@H]1[C@H]2Cc3ccc(-c4ccn(C)c(=O)c4)cc3[C@]1(C)CCN2C(=O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C28H28N4O2/c1-17-25-14-20-5-4-18(19-8-10-31(3)26(33)15-19)12-22(20)28(17,2)9-11-32(25)27(34)21-6-7-23-24(13-21)30-16-29-23/h4-8,10,12-13,15-17,25H,9,11,14H2,1-3H3,(H,29,30)/t17-,25-,28-/m1/s1 |
| InChIKey | LMVICTTXLYTNKO-ZSRPKCNMSA-N |
| XLogP | 4.29 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |