C21H19ClN4O — CID 67223418
(4aS,9aR)-1-(3H-benzimidazole-5-carbonyl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridine-6-carbonitrile;hydrochloride (PubChem CID 67223418) has the molecular formula C21H19ClN4O and a molecular weight of 378.86 g/mol. Its IUPAC name is (4aS,9aR)-1-(3H-benzimidazole-5-carbonyl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridine-6-carbonitrile;hydrochloride.
| Compound Name | (4aS,9aR)-1-(3H-benzimidazole-5-carbonyl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridine-6-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 67223418 |
| Molecular Formula | C21H19ClN4O |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (4aS,9aR)-1-(3H-benzimidazole-5-carbonyl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridine-6-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccc2c(c1)[C@@H]1CCCN(C(=O)c3ccc4nc[nH]c4c3)[C@@H]1C2 |
| InChI | InChI=1S/C21H18N4O.ClH/c22-11-13-3-4-14-10-20-16(17(14)8-13)2-1-7-25(20)21(26)15-5-6-18-19(9-15)24-12-23-18;/h3-6,8-9,12,16,20H,1-2,7,10H2,(H,23,24);1H/t16-,20+;/m0./s1 |
| InChIKey | XBTNKMAQSPPTRX-VASSOYJASA-N |
| XLogP | 3.80 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |