C25H27N3O2 — CID 67969113
[(4aR,9aS)-6-(oxan-4-yl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(3H-benzimidazol-5-yl)methanone (PubChem CID 67969113) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is [(4aR,9aS)-6-(oxan-4-yl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(3H-benzimidazol-5-yl)methanone.
| Compound Name | [(4aR,9aS)-6-(oxan-4-yl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(3H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 67969113 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | [(4aR,9aS)-6-(oxan-4-yl)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-(3H-benzimidazol-5-yl)methanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCC[C@@H]2c3cc(C4CCOCC4)ccc3C[C@@H]21 |
| InChI | InChI=1S/C25H27N3O2/c29-25(19-5-6-22-23(13-19)27-15-26-22)28-9-1-2-20-21-12-17(16-7-10-30-11-8-16)3-4-18(21)14-24(20)28/h3-6,12-13,15-16,20,24H,1-2,7-11,14H2,(H,26,27)/t20-,24+/m1/s1 |
| InChIKey | RGNUWCSONAQZKC-YKSBVNFPSA-N |
| XLogP | 4.40 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |