C28H30N4O — CID 58375146
[(1S,12R)-6-cyclopropyl-1,16,16-trimethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]-(3H-indol-5-yl)methanone (PubChem CID 58375146) has the molecular formula C28H30N4O and a molecular weight of 438.58 g/mol. Its IUPAC name is [(1S,12R)-6-cyclopropyl-1,16,16-trimethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]-(3H-indol-5-yl)methanone.
| Compound Name | [(1S,12R)-6-cyclopropyl-1,16,16-trimethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]-(3H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 58375146 |
| Molecular Formula | C28H30N4O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | [(1S,12R)-6-cyclopropyl-1,16,16-trimethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]-(3H-indol-5-yl)methanone |
| SMILES | CC1(C)[C@H]2Cc3cc4[nH]c(C5CC5)nc4cc3[C@]1(C)CCN2C(=O)c1ccc2c(c1)CC=N2 |
| InChI | InChI=1S/C28H30N4O/c1-27(2)24-14-19-13-22-23(31-25(30-22)16-4-5-16)15-20(19)28(27,3)9-11-32(24)26(33)18-6-7-21-17(12-18)8-10-29-21/h6-7,10,12-13,15-16,24H,4-5,8-9,11,14H2,1-3H3,(H,30,31)/t24-,28+/m1/s1 |
| InChIKey | ZVMZNDISCKPTJA-YWEHKCAJSA-N |
| XLogP | 5.45 |
| TPSA | 61.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |