C21H24F3N3O — CID 58375234
1-[(1S,12R)-6-cyclopropyl-1,16,16-trimethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]-2,2,2-trifluoroethanone (PubChem CID 58375234) has the molecular formula C21H24F3N3O and a molecular weight of 391.44 g/mol. Its IUPAC name is 1-[(1S,12R)-6-cyclopropyl-1,16,16-trimethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(1S,12R)-6-cyclopropyl-1,16,16-trimethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 58375234 |
| Molecular Formula | C21H24F3N3O |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-[(1S,12R)-6-cyclopropyl-1,16,16-trimethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]-2,2,2-trifluoroethanone |
| SMILES | CC1(C)[C@H]2Cc3cc4[nH]c(C5CC5)nc4cc3[C@]1(C)CCN2C(=O)C(F)(F)F |
| InChI | InChI=1S/C21H24F3N3O/c1-19(2)16-9-12-8-14-15(26-17(25-14)11-4-5-11)10-13(12)20(19,3)6-7-27(16)18(28)21(22,23)24/h8,10-11,16H,4-7,9H2,1-3H3,(H,25,26)/t16-,20+/m1/s1 |
| InChIKey | QHLYDCNXYIVQSR-UZLBHIALSA-N |
| XLogP | 4.44 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |