C22H33NO3 — CID 58123547
tert-butyl (1S,9R)-4-methoxy-1,5,13,13-tetramethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carboxylate (PubChem CID 58123547) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is tert-butyl (1S,9R)-4-methoxy-1,5,13,13-tetramethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carboxylate.
| Compound Name | tert-butyl (1S,9R)-4-methoxy-1,5,13,13-tetramethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carboxylate |
|---|---|
| PubChem CID | 58123547 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | tert-butyl (1S,9R)-4-methoxy-1,5,13,13-tetramethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carboxylate |
| SMILES | COc1cc2c(cc1C)C[C@H]1N(C(=O)OC(C)(C)C)CC[C@]2(C)C1(C)C |
| InChI | InChI=1S/C22H33NO3/c1-14-11-15-12-18-21(5,6)22(7,16(15)13-17(14)25-8)9-10-23(18)19(24)26-20(2,3)4/h11,13,18H,9-10,12H2,1-8H3/t18-,22+/m1/s1 |
| InChIKey | SLRHVVZKZCRPGV-GCJKJVERSA-N |
| XLogP | 4.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |