C23H34N2O4S — CID 58497726
(1S,9S)-10-(4-methoxycyclohexanecarbonyl)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-sulfonamide (PubChem CID 58497726) has the molecular formula C23H34N2O4S and a molecular weight of 434.60 g/mol. Its IUPAC name is (1S,9S)-10-(4-methoxycyclohexanecarbonyl)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-sulfonamide.
| Compound Name | (1S,9S)-10-(4-methoxycyclohexanecarbonyl)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-sulfonamide |
|---|---|
| PubChem CID | 58497726 |
| Molecular Formula | C23H34N2O4S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (1S,9S)-10-(4-methoxycyclohexanecarbonyl)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-sulfonamide |
| SMILES | COC1CCC(C(=O)N2CC[C@@]3(C)c4cc(S(N)(=O)=O)ccc4C[C@H]2C3(C)C)CC1 |
| InChI | InChI=1S/C23H34N2O4S/c1-22(2)20-13-16-7-10-18(30(24,27)28)14-19(16)23(22,3)11-12-25(20)21(26)15-5-8-17(29-4)9-6-15/h7,10,14-15,17,20H,5-6,8-9,11-13H2,1-4H3,(H2,24,27,28)/t15?,17?,20-,23-/m0/s1 |
| InChIKey | UERBTZGTYOSMHS-RIYPLTIVSA-N |
| XLogP | 2.98 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |