C28H36N2O5S — CID 70666522
N-[(3R)-3-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]cyclopentyl]-2-methoxybenzenesulfonamide (PubChem CID 70666522) has the molecular formula C28H36N2O5S and a molecular weight of 512.67 g/mol. Its IUPAC name is N-[(3R)-3-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]cyclopentyl]-2-methoxybenzenesulfonamide.
| Compound Name | N-[(3R)-3-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]cyclopentyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 70666522 |
| Molecular Formula | C28H36N2O5S |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | N-[(3R)-3-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]cyclopentyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)NC1CC[C@@H](C(=O)N2CC[C@@]3(C)c4cccc(O)c4C[C@@H]2C3(C)C)C1 |
| InChI | InChI=1S/C28H36N2O5S/c1-27(2)25-17-20-21(8-7-9-22(20)31)28(27,3)14-15-30(25)26(32)18-12-13-19(16-18)29-36(33,34)24-11-6-5-10-23(24)35-4/h5-11,18-19,25,29,31H,12-17H2,1-4H3/t18-,19?,25-,28+/m1/s1 |
| InChIKey | ZADSUBDTGHGBHT-PAQDAYAISA-N |
| XLogP | 3.99 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |