C23H33N3O3 — CID 70666305
N-ethyl-3-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]pyrrolidine-1-carboxamide (PubChem CID 70666305) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-ethyl-3-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]pyrrolidine-1-carboxamide.
| Compound Name | N-ethyl-3-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 70666305 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | N-ethyl-3-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]pyrrolidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC(C(=O)N2CC[C@@]3(C)c4cccc(O)c4C[C@@H]2C3(C)C)C1 |
| InChI | InChI=1S/C23H33N3O3/c1-5-24-21(29)25-11-9-15(14-25)20(28)26-12-10-23(4)17-7-6-8-18(27)16(17)13-19(26)22(23,2)3/h6-8,15,19,27H,5,9-14H2,1-4H3,(H,24,29)/t15?,19-,23+/m1/s1 |
| InChIKey | ABHOHBUEUBKBOY-WQMGONBFSA-N |
| XLogP | 2.88 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |