C25H36N2O3 — CID 58497766
1-[2-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]piperidin-1-yl]butan-1-one (PubChem CID 58497766) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is 1-[2-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]piperidin-1-yl]butan-1-one.
| Compound Name | 1-[2-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 58497766 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 1-[2-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]piperidin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCCCC1C(=O)N1CC[C@@]2(C)c3cccc(O)c3C[C@@H]1C2(C)C |
| InChI | InChI=1S/C25H36N2O3/c1-5-9-22(29)26-14-7-6-11-19(26)23(30)27-15-13-25(4)18-10-8-12-20(28)17(18)16-21(27)24(25,2)3/h8,10,12,19,21,28H,5-7,9,11,13-16H2,1-4H3/t19?,21-,25+/m1/s1 |
| InChIKey | IRGFZOISHZVQAW-RLOJFFRMSA-N |
| XLogP | 4.01 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |