C26H37NO4 — CID 143893050
ethyl (1S)-10-(4-methoxycyclohexanecarbonyl)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-6-carboxylate (PubChem CID 143893050) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is ethyl (1S)-10-(4-methoxycyclohexanecarbonyl)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-6-carboxylate.
| Compound Name | ethyl (1S)-10-(4-methoxycyclohexanecarbonyl)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-6-carboxylate |
|---|---|
| PubChem CID | 143893050 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | ethyl (1S)-10-(4-methoxycyclohexanecarbonyl)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-6-carboxylate |
| SMILES | CCOC(=O)c1cccc2c1CC1N(C(=O)C3CCC(OC)CC3)CC[C@]2(C)C1(C)C |
| InChI | InChI=1S/C26H37NO4/c1-6-31-24(29)19-8-7-9-21-20(19)16-22-25(2,3)26(21,4)14-15-27(22)23(28)17-10-12-18(30-5)13-11-17/h7-9,17-18,22H,6,10-16H2,1-5H3/t17?,18?,22?,26-/m0/s1 |
| InChIKey | MXOBEVQNXADHPV-WVLUKUQJSA-N |
| XLogP | 4.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |