C16H22INO3 — CID 169449798
ethyl 2-iodo-3-[(4-methoxypiperidin-1-yl)methyl]benzoate (PubChem CID 169449798) has the molecular formula C16H22INO3 and a molecular weight of 403.26 g/mol. Its IUPAC name is ethyl 2-iodo-3-[(4-methoxypiperidin-1-yl)methyl]benzoate.
| Compound Name | ethyl 2-iodo-3-[(4-methoxypiperidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 169449798 |
| Molecular Formula | C16H22INO3 |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | ethyl 2-iodo-3-[(4-methoxypiperidin-1-yl)methyl]benzoate |
| SMILES | CCOC(=O)c1cccc(CN2CCC(OC)CC2)c1I |
| InChI | InChI=1S/C16H22INO3/c1-3-21-16(19)14-6-4-5-12(15(14)17)11-18-9-7-13(20-2)8-10-18/h4-6,13H,3,7-11H2,1-2H3 |
| InChIKey | NYEJVDMSDDKIPU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|