C16H19F3INO2 — CID 169449797
ethyl 2-iodo-3-[[4-(trifluoromethyl)piperidin-1-yl]methyl]benzoate (PubChem CID 169449797) has the molecular formula C16H19F3INO2 and a molecular weight of 441.23 g/mol. Its IUPAC name is ethyl 2-iodo-3-[[4-(trifluoromethyl)piperidin-1-yl]methyl]benzoate.
| Compound Name | ethyl 2-iodo-3-[[4-(trifluoromethyl)piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 169449797 |
| Molecular Formula | C16H19F3INO2 |
| Molecular Weight | 441.23 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | ethyl 2-iodo-3-[[4-(trifluoromethyl)piperidin-1-yl]methyl]benzoate |
| SMILES | CCOC(=O)c1cccc(CN2CCC(C(F)(F)F)CC2)c1I |
| InChI | InChI=1S/C16H19F3INO2/c1-2-23-15(22)13-5-3-4-11(14(13)20)10-21-8-6-12(7-9-21)16(17,18)19/h3-5,12H,2,6-10H2,1H3 |
| InChIKey | NRPAOOIQCONIDZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.23 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|