C20H29IN2O4 — CID 169449804
ethyl 2-iodo-3-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]methyl]benzoate (PubChem CID 169449804) has the molecular formula C20H29IN2O4 and a molecular weight of 488.37 g/mol. Its IUPAC name is ethyl 2-iodo-3-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]methyl]benzoate.
| Compound Name | ethyl 2-iodo-3-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 169449804 |
| Molecular Formula | C20H29IN2O4 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | ethyl 2-iodo-3-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]methyl]benzoate |
| SMILES | CCOC(=O)c1cccc(CN2CCC[C@@H](NC(=O)OC(C)(C)C)C2)c1I |
| InChI | InChI=1S/C20H29IN2O4/c1-5-26-18(24)16-10-6-8-14(17(16)21)12-23-11-7-9-15(13-23)22-19(25)27-20(2,3)4/h6,8,10,15H,5,7,9,11-13H2,1-4H3,(H,22,25)/t15-/m1/s1 |
| InChIKey | HZZTXEMFCFUKOD-OAHLLOKOSA-N |
| XLogP | 3.96 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|