C20H29IN2O4 — CID 169449809
tert-butyl 4-[(3-ethoxycarbonyl-2-iodophenyl)methyl]-3-methylpiperazine-1-carboxylate (PubChem CID 169449809) has the molecular formula C20H29IN2O4 and a molecular weight of 488.37 g/mol. Its IUPAC name is tert-butyl 4-[(3-ethoxycarbonyl-2-iodophenyl)methyl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-ethoxycarbonyl-2-iodophenyl)methyl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 169449809 |
| Molecular Formula | C20H29IN2O4 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | tert-butyl 4-[(3-ethoxycarbonyl-2-iodophenyl)methyl]-3-methylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)c1cccc(CN2CCN(C(=O)OC(C)(C)C)CC2C)c1I |
| InChI | InChI=1S/C20H29IN2O4/c1-6-26-18(24)16-9-7-8-15(17(16)21)13-22-10-11-23(12-14(22)2)19(25)27-20(3,4)5/h7-9,14H,6,10-13H2,1-5H3 |
| InChIKey | ZOYNLDCLISVZCD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|