C18H26F3NO3 — CID 170757268
ethane;2-(ethoxymethyl)-6-[4-(trifluoromethyl)piperidin-1-yl]benzoic acid (PubChem CID 170757268) has the molecular formula C18H26F3NO3 and a molecular weight of 361.40 g/mol. Its IUPAC name is ethane;2-(ethoxymethyl)-6-[4-(trifluoromethyl)piperidin-1-yl]benzoic acid.
| Compound Name | ethane;2-(ethoxymethyl)-6-[4-(trifluoromethyl)piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 170757268 |
| Molecular Formula | C18H26F3NO3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | ethane;2-(ethoxymethyl)-6-[4-(trifluoromethyl)piperidin-1-yl]benzoic acid |
| SMILES | CC.CCOCc1cccc(N2CCC(C(F)(F)F)CC2)c1C(=O)O |
| InChI | InChI=1S/C16H20F3NO3.C2H6/c1-2-23-10-11-4-3-5-13(14(11)15(21)22)20-8-6-12(7-9-20)16(17,18)19;1-2/h3-5,12H,2,6-10H2,1H3,(H,21,22);1-2H3 |
| InChIKey | BJXBRLOPSSLYDN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |