C16H21F2NO2 — CID 170756957
2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzamide (PubChem CID 170756957) has the molecular formula C16H21F2NO2 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzamide.
| Compound Name | 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzamide |
|---|---|
| PubChem CID | 170756957 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzamide |
| SMILES | CCOCc1cccc(C2CCC(F)(F)CC2)c1C(N)=O |
| InChI | InChI=1S/C16H21F2NO2/c1-2-21-10-12-4-3-5-13(14(12)15(19)20)11-6-8-16(17,18)9-7-11/h3-5,11H,2,6-10H2,1H3,(H2,19,20) |
| InChIKey | DBGOGAVESLPAAC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |