C27H34N2OS — CID 143893005
[(3R)-3-(phenylsulfanylamino)cyclopentyl]-[(1S)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone (PubChem CID 143893005) has the molecular formula C27H34N2OS and a molecular weight of 434.65 g/mol. Its IUPAC name is [(3R)-3-(phenylsulfanylamino)cyclopentyl]-[(1S)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone.
| Compound Name | [(3R)-3-(phenylsulfanylamino)cyclopentyl]-[(1S)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone |
|---|---|
| PubChem CID | 143893005 |
| Molecular Formula | C27H34N2OS |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | [(3R)-3-(phenylsulfanylamino)cyclopentyl]-[(1S)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone |
| SMILES | CC1(C)C2Cc3ccccc3[C@]1(C)CCN2C(=O)C1CC[C@@H](NSc2ccccc2)C1 |
| InChI | InChI=1S/C27H34N2OS/c1-26(2)24-18-19-9-7-8-12-23(19)27(26,3)15-16-29(24)25(30)20-13-14-21(17-20)28-31-22-10-5-4-6-11-22/h4-12,20-21,24,28H,13-18H2,1-3H3/t20?,21-,24?,27+/m1/s1 |
| InChIKey | YGHYCJYROYHNNU-RSCDXCQASA-N |
| XLogP | 5.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|